C46H30N4 — CID 146185375
3-phenyl-1-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzo[f]quinoline (PubChem CID 146185375) has the molecular formula C46H30N4 and a molecular weight of 638.77 g/mol. Its IUPAC name is 3-phenyl-1-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzo[f]quinoline.
| Compound Name | 3-phenyl-1-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzo[f]quinoline |
|---|---|
| PubChem CID | 146185375 |
| Molecular Formula | C46H30N4 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 3-phenyl-1-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzo[f]quinoline |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cc(-c6ccccc6)nc6ccc7ccccc7c56)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C46H30N4/c1-4-13-31(14-5-1)37-20-12-21-38(29-37)46-49-44(35-18-8-3-9-19-35)48-45(50-46)36-25-23-33(24-26-36)40-30-42(34-16-6-2-7-17-34)47-41-28-27-32-15-10-11-22-39(32)43(40)41/h1-30H |
| InChIKey | FFZZCADTJAPSSZ-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|