C24H30N2O3 — CID 1461856
N-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3,4-dimethoxybenzamide (PubChem CID 1461856) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1461856 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[(1S,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2C[C@@H]3CCC[C@@H](C2)N3Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H30N2O3/c1-28-22-12-11-18(13-23(22)29-2)24(27)25-19-14-20-9-6-10-21(15-19)26(20)16-17-7-4-3-5-8-17/h3-5,7-8,11-13,19-21H,6,9-10,14-16H2,1-2H3,(H,25,27)/t20-,21-/m0/s1 |
| InChIKey | FYVUOSONMJILCC-SFTDATJTSA-N |
| XLogP | 4.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |