C48H30N6 — CID 146185651
3-phenyl-1-[4-[4-(4-pyridin-3-yl-6-pyridin-4-yl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzo[f]quinoline (PubChem CID 146185651) has the molecular formula C48H30N6 and a molecular weight of 690.81 g/mol. Its IUPAC name is 3-phenyl-1-[4-[4-(4-pyridin-3-yl-6-pyridin-4-yl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzo[f]quinoline.
| Compound Name | 3-phenyl-1-[4-[4-(4-pyridin-3-yl-6-pyridin-4-yl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzo[f]quinoline |
|---|---|
| PubChem CID | 146185651 |
| Molecular Formula | C48H30N6 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 3-phenyl-1-[4-[4-(4-pyridin-3-yl-6-pyridin-4-yl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]benzo[f]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-c5nc(-c6ccncc6)nc(-c6cccnc6)n5)c5ccccc45)cc3)c3c(ccc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C48H30N6/c1-2-10-34(11-3-1)44-29-42(45-38-13-5-4-9-31(38)20-23-43(45)51-44)33-18-16-32(17-19-33)37-21-22-41(40-15-7-6-14-39(37)40)48-53-46(35-24-27-49-28-25-35)52-47(54-48)36-12-8-26-50-30-36/h1-30H |
| InChIKey | HCDVPTLFAWSKKA-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|