C15H28O — CID 146185928
(3R)-3,6-dimethyl-6-pentan-3-yl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran (PubChem CID 146185928) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (3R)-3,6-dimethyl-6-pentan-3-yl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran.
| Compound Name | (3R)-3,6-dimethyl-6-pentan-3-yl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 146185928 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (3R)-3,6-dimethyl-6-pentan-3-yl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
| SMILES | CCC(CC)C1(C)CCC2C(C1)OC[C@@H]2C |
| InChI | InChI=1S/C15H28O/c1-5-12(6-2)15(4)8-7-13-11(3)10-16-14(13)9-15/h11-14H,5-10H2,1-4H3/t11-,13?,14?,15?/m0/s1 |
| InChIKey | ZZNOEEHOGCNRNF-WXPVAWKNSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |