About (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine
(Z)-1-cyclohexyl-N'-methylethene-1,2-diamine (PubChem CID 146186010) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine |
| PubChem CID | 146186010 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine |
| SMILES | CN/C=C(\N)C1CCCCC1 |
| InChI | InChI=1S/C9H18N2/c1-11-7-9(10)8-5-3-2-4-6-8/h7-8,11H,2-6,10H2,1H3/b9-7- |
| InChIKey | HDZVMOLMKWCVDG-CLFYSBASSA-N |
| XLogP | 1.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine?
The IUPAC name of (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine (CID 146186010) is (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine.
What is the SMILES notation for (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine?
The canonical SMILES for (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine is CN/C=C(\N)C1CCCCC1.
What is the InChIKey of (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine?
The InChIKey is HDZVMOLMKWCVDG-CLFYSBASSA-N. The full InChI is InChI=1S/C9H18N2/c1-11-7-9(10)8-5-3-2-4-6-8/h7-8,11H,2-6,10H2,1H3/b9-7-.
What are the key properties of (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine?
(Z)-1-cyclohexyl-N'-methylethene-1,2-diamine has a molecular weight of 154.26 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclohexyl-N'-methylethene-1,2-diamine is sourced from PubChem (CID 146186010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).