C25H20N8O2 — CID 146186200
(2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-benzyl-2-phenylacetamide (PubChem CID 146186200) has the molecular formula C25H20N8O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-benzyl-2-phenylacetamide.
| Compound Name | (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-benzyl-2-phenylacetamide |
|---|---|
| PubChem CID | 146186200 |
| Molecular Formula | C25H20N8O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-benzyl-2-phenylacetamide |
| SMILES | Nc1nc2c(cnn2[C@H](C(=O)NCc2ccccc2)c2ccccc2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H20N8O2/c26-25-30-23-18(22-29-21(31-33(22)25)19-12-7-13-35-19)15-28-32(23)20(17-10-5-2-6-11-17)24(34)27-14-16-8-3-1-4-9-16/h1-13,15,20H,14H2,(H2,26,30)(H,27,34)/t20-/m0/s1 |
| InChIKey | HHAPSKPCJCLLPK-FQEVSTJZSA-N |
| XLogP | 3.22 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |