C34H38N10O4 — CID 146186378
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-2-phenylpropanamide (PubChem CID 146186378) has the molecular formula C34H38N10O4 and a molecular weight of 650.74 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-2-phenylpropanamide.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 146186378 |
| Molecular Formula | C34H38N10O4 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-2-phenylpropanamide |
| SMILES | COCCOc1ccc(N2CCN(CCNC(=O)C(C)(c3ccccc3)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C34H38N10O4/c1-34(24-7-4-3-5-8-24,44-31-27(23-37-44)30-38-29(28-9-6-20-48-28)40-43(30)33(35)39-31)32(45)36-14-15-41-16-18-42(19-17-41)25-10-12-26(13-11-25)47-22-21-46-2/h3-13,20,23H,14-19,21-22H2,1-2H3,(H2,35,39)(H,36,45) |
| InChIKey | ZTTFARHAZTYTHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|