C18H23N7O — CID 146186432
(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone (PubChem CID 146186432) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone.
| Compound Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 146186432 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone |
| SMILES | C[C@H](Nc1ncc(C(=O)N2CC3CN(C)CC3C2)cn1)c1cnccn1 |
| InChI | InChI=1S/C18H23N7O/c1-12(16-7-19-3-4-20-16)23-18-21-5-13(6-22-18)17(26)25-10-14-8-24(2)9-15(14)11-25/h3-7,12,14-15H,8-11H2,1-2H3,(H,21,22,23)/t12-,14?,15?/m0/s1 |
| InChIKey | HFGHEUHEPBJJAV-GRTSSRMGSA-N |
| XLogP | 1.07 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |