C14H13N3O2S — CID 146186539
N-(4-ethoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 146186539) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 146186539 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(4-ethoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc3scnc3[nH]2)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-2-19-10-5-3-9(4-6-10)16-14(18)11-7-12-13(17-11)15-8-20-12/h3-8,17H,2H2,1H3,(H,16,18) |
| InChIKey | INQCGYLJGZDZGN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |