C21H32N4OS — CID 146186623
N-[[5-(1-ethoxyethenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-2-methyl-N-propylpent-1-en-3-amine (PubChem CID 146186623) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is N-[[5-(1-ethoxyethenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-2-methyl-N-propylpent-1-en-3-amine.
| Compound Name | N-[[5-(1-ethoxyethenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-2-methyl-N-propylpent-1-en-3-amine |
|---|---|
| PubChem CID | 146186623 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[[5-(1-ethoxyethenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-2-methyl-N-propylpent-1-en-3-amine |
| SMILES | C=C(OCC)C1=C(CN(CCC)C(CC)C(=C)C)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C21H32N4OS/c1-7-11-25(19(8-2)15(4)5)14-18-17(16(6)26-9-3)13-23-20(24-18)21-22-10-12-27-21/h10,12,19H,4,6-9,11,13-14H2,1-3,5H3,(H,23,24) |
| InChIKey | NYUOEUBMTWZLRU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|