C13H16O2 — CID 146187278
(7S)-9-hydroxy-9,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 146187278) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (7S)-9-hydroxy-9,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (7S)-9-hydroxy-9,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 146187278 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (7S)-9-hydroxy-9,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | CC1=CC2C3CC=CC3[C@@H]1C(=O)C2(C)O |
| InChI | InChI=1S/C13H16O2/c1-7-6-10-8-4-3-5-9(8)11(7)12(14)13(10,2)15/h3,5-6,8-11,15H,4H2,1-2H3/t8?,9?,10?,11-,13?/m1/s1 |
| InChIKey | VKXMHWZNWCSVBP-VBRVDACPSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|