C13H16O3 — CID 146187574
(7S)-9-hydroxy-11-methoxy-9-methyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 146187574) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (7S)-9-hydroxy-11-methoxy-9-methyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (7S)-9-hydroxy-11-methoxy-9-methyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 146187574 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (7S)-9-hydroxy-11-methoxy-9-methyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | COC1=CC2C3CC=CC3[C@@H]1C(=O)C2(C)O |
| InChI | InChI=1S/C13H16O3/c1-13(15)9-6-10(16-2)11(12(13)14)8-5-3-4-7(8)9/h3,5-9,11,15H,4H2,1-2H3/t7?,8?,9?,11-,13?/m0/s1 |
| InChIKey | IIGXNWYRHNWJEH-CWMRXXDBSA-N |
| XLogP | 1.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|