C24H32N6O3S — CID 146188250
N'-[[3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrimidin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine (PubChem CID 146188250) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is N'-[[3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrimidin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[[3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrimidin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 146188250 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N'-[[3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrimidin-2-yl]phenyl]methyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCc1cccc(-c2nc(-c3c(C)noc3C)c(C)c(N3CCS(=O)(=O)CC3)n2)c1 |
| InChI | InChI=1S/C24H32N6O3S/c1-16-22(21-17(2)29-33-18(21)3)27-23(28-24(16)30-10-12-34(31,32)13-11-30)20-7-5-6-19(14-20)15-26-9-8-25-4/h5-7,14,25-26H,8-13,15H2,1-4H3 |
| InChIKey | IXCPIUUIBHEBPT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|