C30H44N4O6 — CID 146188378
[(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 146188378) has the molecular formula C30H44N4O6 and a molecular weight of 556.70 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146188378 |
| Molecular Formula | C30H44N4O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\C(C)c1ncccn1)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C30H44N4O6/c1-21(8-6-9-23(3)28-31-14-7-15-32-28)27-22(2)10-11-25(39-29(37)34-18-16-33(5)17-19-34)30(4,38)13-12-24(35)20-26(36)40-27/h6-11,14-15,22-25,27,35,38H,12-13,16-20H2,1-5H3/b9-6+,11-10+,21-8+/t22-,23?,24+,25-,27+,30+/m0/s1 |
| InChIKey | SCZXWXBIBYWDNU-IZCUXPKASA-N |
| XLogP | 3.24 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|