C36H57N3O4 — CID 146188512
(4R,7R,8S,9E,11S,12S)-4,7-dihydroxy-7,8,11-trimethyl-12-[(2E,4E)-5-[3-[methyl(propyl)amino]cycloheptyl]-6-pyrimidin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 146188512) has the molecular formula C36H57N3O4 and a molecular weight of 595.87 g/mol. Its IUPAC name is (4R,7R,8S,9E,11S,12S)-4,7-dihydroxy-7,8,11-trimethyl-12-[(2E,4E)-5-[3-[methyl(propyl)amino]cycloheptyl]-6-pyrimidin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,8S,9E,11S,12S)-4,7-dihydroxy-7,8,11-trimethyl-12-[(2E,4E)-5-[3-[methyl(propyl)amino]cycloheptyl]-6-pyrimidin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 146188512 |
| Molecular Formula | C36H57N3O4 |
| Molecular Weight | 595.87 g/mol |
| Exact Mass | 595.43 |
| IUPAC Name | (4R,7R,8S,9E,11S,12S)-4,7-dihydroxy-7,8,11-trimethyl-12-[(2E,4E)-5-[3-[methyl(propyl)amino]cycloheptyl]-6-pyrimidin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | CCCN(C)C1CCCCC(/C(=C\C=C(/C)[C@H]2OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](C)/C=C/[C@@H]2C)C(C)c2ccncn2)C1 |
| InChI | InChI=1S/C36H57N3O4/c1-8-21-39(7)30-12-10-9-11-29(22-30)32(28(5)33-18-20-37-24-38-33)16-14-26(3)35-25(2)13-15-27(4)36(6,42)19-17-31(40)23-34(41)43-35/h13-16,18,20,24-25,27-31,35,40,42H,8-12,17,19,21-23H2,1-7H3/b15-13+,26-14+,32-16-/t25-,27-,28?,29?,30?,31+,35-,36+/m0/s1 |
| InChIKey | UUXOIZVDVNFTBG-WWCPMTDHSA-N |
| XLogP | 6.78 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.87 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|