About 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane
3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane (PubChem CID 146188671) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane |
| PubChem CID | 146188671 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane |
| SMILES | CN1CCC2(CC(CN3CCC4(CCCN4)C3)CN2)C1 |
| InChI | InChI=1S/C16H30N4/c1-19-7-4-16(12-19)9-14(10-18-16)11-20-8-5-15(13-20)3-2-6-17-15/h14,17-18H,2-13H2,1H3 |
| InChIKey | FTRDRAWOZMDVAJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane?
The IUPAC name of 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane (CID 146188671) is 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane?
The canonical SMILES for 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane is CN1CCC2(CC(CN3CCC4(CCCN4)C3)CN2)C1.
What is the InChIKey of 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane?
The InChIKey is FTRDRAWOZMDVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-19-7-4-16(12-19)9-14(10-18-16)11-20-8-5-15(13-20)3-2-6-17-15/h14,17-18H,2-13H2,1H3.
What are the key properties of 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane?
3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane has a molecular weight of 278.44 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,7-diazaspiro[4.4]nonan-7-ylmethyl)-7-methyl-1,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 146188671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).