C15H18O2 — CID 146188677
4-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]oxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 146188677) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]oxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 4-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]oxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 146188677 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]oxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | C=C(/C=C\C(C)=C/C)OC1=CCC(C=O)C=C1 |
| InChI | InChI=1S/C15H18O2/c1-4-12(2)5-6-13(3)17-15-9-7-14(11-16)8-10-15/h4-7,9-11,14H,3,8H2,1-2H3/b6-5-,12-4- |
| InChIKey | SFWZXFKEDPHORJ-RSNHHAHHSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|