C35H34O6 — CID 146188821
[5-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-methylphenyl]-2,3-dihydro-1H-inden-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 146188821) has the molecular formula C35H34O6 and a molecular weight of 550.65 g/mol. Its IUPAC name is [5-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-methylphenyl]-2,3-dihydro-1H-inden-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-methylphenyl]-2,3-dihydro-1H-inden-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146188821 |
| Molecular Formula | C35H34O6 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [5-[4-[2,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-methylphenyl]-2,3-dihydro-1H-inden-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1Cc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)cc4OC(=O)C(=C)C)cc3C)cc2C1 |
| InChI | InChI=1S/C35H34O6/c1-20(2)33(36)39-19-24-15-25-8-9-27(17-28(25)16-24)30-12-10-26(14-23(30)7)31-13-11-29(40-34(37)21(3)4)18-32(31)41-35(38)22(5)6/h8-14,17-18,24H,1,3,5,15-16,19H2,2,4,6-7H3 |
| InChIKey | BXWYBQXWQKPCOT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|