About 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol
4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol (PubChem CID 146189342) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol |
| PubChem CID | 146189342 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol |
| SMILES | CN(C)CC1=CC(O)NC=C1 |
| InChI | InChI=1S/C8H14N2O/c1-10(2)6-7-3-4-9-8(11)5-7/h3-5,8-9,11H,6H2,1-2H3 |
| InChIKey | FKOPTKCMCFGFIV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol?
The IUPAC name of 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol (CID 146189342) is 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol?
The canonical SMILES for 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol is CN(C)CC1=CC(O)NC=C1.
What is the InChIKey of 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol?
The InChIKey is FKOPTKCMCFGFIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10(2)6-7-3-4-9-8(11)5-7/h3-5,8-9,11H,6H2,1-2H3.
What are the key properties of 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol?
4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol has a molecular weight of 154.21 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(dimethylamino)methyl]-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 146189342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).