C12H17F2NO — CID 146189356
3,3-difluoro-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypiperidine (PubChem CID 146189356) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 3,3-difluoro-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypiperidine.
| Compound Name | 3,3-difluoro-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypiperidine |
|---|---|
| PubChem CID | 146189356 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3,3-difluoro-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypiperidine |
| SMILES | C=C/C=C\C=C(/C)OC1CCNCC1(F)F |
| InChI | InChI=1S/C12H17F2NO/c1-3-4-5-6-10(2)16-11-7-8-15-9-12(11,13)14/h3-6,11,15H,1,7-9H2,2H3/b5-4-,10-6+ |
| InChIKey | MYFXFAQENVZPQY-VWJYOPCBSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|