C22H34O4 — CID 146189586
2-[[3-[(Z,3E)-3-ethylidene-2,2-dimethyl-6-(oxiran-2-ylmethoxy)hex-4-enyl]cyclohexen-1-yl]oxymethyl]oxirane (PubChem CID 146189586) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[[3-[(Z,3E)-3-ethylidene-2,2-dimethyl-6-(oxiran-2-ylmethoxy)hex-4-enyl]cyclohexen-1-yl]oxymethyl]oxirane.
| Compound Name | 2-[[3-[(Z,3E)-3-ethylidene-2,2-dimethyl-6-(oxiran-2-ylmethoxy)hex-4-enyl]cyclohexen-1-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 146189586 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[[3-[(Z,3E)-3-ethylidene-2,2-dimethyl-6-(oxiran-2-ylmethoxy)hex-4-enyl]cyclohexen-1-yl]oxymethyl]oxirane |
| SMILES | C/C=C(\C=C/COCC1CO1)C(C)(C)CC1C=C(OCC2CO2)CCC1 |
| InChI | InChI=1S/C22H34O4/c1-4-18(8-6-10-23-13-20-14-25-20)22(2,3)12-17-7-5-9-19(11-17)24-15-21-16-26-21/h4,6,8,11,17,20-21H,5,7,9-10,12-16H2,1-3H3/b8-6-,18-4+ |
| InChIKey | VXTSBVZNEVKEAJ-NOLGNASNSA-N |
| XLogP | 4.42 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|