C14H16N4O4 — CID 146189653
methyl 6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxylate (PubChem CID 146189653) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl 6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxylate.
| Compound Name | methyl 6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146189653 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 6-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC3(CC2)NC(=O)NC3=O)nc1 |
| InChI | InChI=1S/C14H16N4O4/c1-22-11(19)9-2-3-10(15-8-9)18-6-4-14(5-7-18)12(20)16-13(21)17-14/h2-3,8H,4-7H2,1H3,(H2,16,17,20,21) |
| InChIKey | JEMKXWPYGUBKAE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|