C11H15FN2O — CID 146189687
1-ethyl-5-[(1-fluoroazetidin-3-yl)methyl]pyridin-2-one (PubChem CID 146189687) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-ethyl-5-[(1-fluoroazetidin-3-yl)methyl]pyridin-2-one.
| Compound Name | 1-ethyl-5-[(1-fluoroazetidin-3-yl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 146189687 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-ethyl-5-[(1-fluoroazetidin-3-yl)methyl]pyridin-2-one |
| SMILES | CCn1cc(CC2CN(F)C2)ccc1=O |
| InChI | InChI=1S/C11H15FN2O/c1-2-13-6-9(3-4-11(13)15)5-10-7-14(12)8-10/h3-4,6,10H,2,5,7-8H2,1H3 |
| InChIKey | NWPAMYYLXRAIDB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|