About 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide
2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 146190140) has the molecular formula C12H9N3OS
and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 146190140 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | N#CCC(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C12H9N3OS/c13-7-6-11(16)15-12-14-8-10(17-12)9-4-2-1-3-5-9/h1-5,8H,6H2,(H,14,15,16) |
| InChIKey | NYKHAGAXQJJHJN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (CID 146190140) is 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide is N#CCC(=O)Nc1ncc(-c2ccccc2)s1.
What is the InChIKey of 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is NYKHAGAXQJJHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3OS/c13-7-6-11(16)15-12-14-8-10(17-12)9-4-2-1-3-5-9/h1-5,8H,6H2,(H,14,15,16).
What are the key properties of 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 243.29 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(5-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 146190140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).