About anthracene;furan
anthracene;furan (PubChem CID 146190380) has the molecular formula C18H14O
and a molecular weight of 246.31 g/mol. Its IUPAC name is anthracene;furan.
Molecular Properties
| Compound Name | anthracene;furan |
| PubChem CID | 146190380 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | anthracene;furan |
| SMILES | c1ccc2cc3ccccc3cc2c1.c1ccoc1 |
| InChI | InChI=1S/C14H10.C4H4O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-4-5-3-1/h1-10H;1-4H |
| InChIKey | GBGSMFSPTNKMIT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;furan?
The IUPAC name of anthracene;furan (CID 146190380) is anthracene;furan.
What is the SMILES notation for anthracene;furan?
The canonical SMILES for anthracene;furan is c1ccc2cc3ccccc3cc2c1.c1ccoc1.
What is the InChIKey of anthracene;furan?
The InChIKey is GBGSMFSPTNKMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H4O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-4-5-3-1/h1-10H;1-4H.
What are the key properties of anthracene;furan?
anthracene;furan has a molecular weight of 246.31 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;furan is sourced from PubChem (CID 146190380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).