About 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid
3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid (PubChem CID 146191093) has the molecular formula C19H16Cl2N4O3S
and a molecular weight of 451.34 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid.
Molecular Properties
| Compound Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid |
| PubChem CID | 146191093 |
| Molecular Formula | C19H16Cl2N4O3S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid |
| SMILES | O=c1oc2nc(N3CCNCC3)ccc2cc1-c1nc2c(Cl)cccc2s1.OCl |
| InChI | InChI=1S/C19H15ClN4O2S.ClHO/c20-13-2-1-3-14-16(13)23-18(27-14)12-10-11-4-5-15(22-17(11)26-19(12)25)24-8-6-21-7-9-24;1-2/h1-5,10,21H,6-9H2;2H |
| InChIKey | JYHDRWATMZFBAP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid?
The IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid (CID 146191093) is 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid.
What is the SMILES notation for 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid?
The canonical SMILES for 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid is O=c1oc2nc(N3CCNCC3)ccc2cc1-c1nc2c(Cl)cccc2s1.OCl.
What is the InChIKey of 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid?
The InChIKey is JYHDRWATMZFBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4O2S.ClHO/c20-13-2-1-3-14-16(13)23-18(27-14)12-10-11-4-5-15(22-17(11)26-19(12)25)24-8-6-21-7-9-24;1-2/h1-5,10,21H,6-9H2;2H.
What are the key properties of 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid?
3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid has a molecular weight of 451.34 g/mol, XLogP of 3.66, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-ylpyrano[2,3-b]pyridin-2-one;hypochlorous acid is sourced from PubChem (CID 146191093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).