C24H34N2O4 — CID 146191407
(4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 146191407) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 146191407 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-pyrimidin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | C/C(=C\C=C\C(C)c1ncccn1)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)C/C=C/[C@@H]1C |
| InChI | InChI=1S/C24H34N2O4/c1-17(8-5-9-19(3)23-25-14-7-15-26-23)22-18(2)10-6-12-24(4,29)13-11-20(27)16-21(28)30-22/h5-10,14-15,18-20,22,27,29H,11-13,16H2,1-4H3/b9-5+,10-6+,17-8+/t18-,19?,20+,22+,24-/m0/s1 |
| InChIKey | AWMXHHOHLURLAX-DRCMWGTESA-N |
| XLogP | 3.87 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|