C25H37N3O2 — CID 146191409
(9E,11S,12S)-12-[(2E,4E)-6-[2-(dimethylamino)pyrimidin-4-yl]hepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one (PubChem CID 146191409) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (9E,11S,12S)-12-[(2E,4E)-6-[2-(dimethylamino)pyrimidin-4-yl]hepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E,11S,12S)-12-[(2E,4E)-6-[2-(dimethylamino)pyrimidin-4-yl]hepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 146191409 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (9E,11S,12S)-12-[(2E,4E)-6-[2-(dimethylamino)pyrimidin-4-yl]hepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C(=C\C=C\C(C)c1ccnc(N(C)C)n1)[C@H]1OC(=O)CCCCCC/C=C/[C@@H]1C |
| InChI | InChI=1S/C25H37N3O2/c1-19(22-17-18-26-25(27-22)28(4)5)14-12-15-21(3)24-20(2)13-10-8-6-7-9-11-16-23(29)30-24/h10,12-15,17-20,24H,6-9,11,16H2,1-5H3/b13-10+,14-12+,21-15+/t19?,20-,24-/m0/s1 |
| InChIKey | DENFUZVFILZNKM-ZKKLSMADSA-N |
| XLogP | 5.61 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|