C14H15N3O3 — CID 146191463
10-amino-2,7-dimethyl-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione (PubChem CID 146191463) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 10-amino-2,7-dimethyl-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione.
| Compound Name | 10-amino-2,7-dimethyl-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione |
|---|---|
| PubChem CID | 146191463 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 10-amino-2,7-dimethyl-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione |
| SMILES | CC1COC(=O)c2c(c3cc(N)ccc3n(C)c2=O)N1 |
| InChI | InChI=1S/C14H15N3O3/c1-7-6-20-14(19)11-12(16-7)9-5-8(15)3-4-10(9)17(2)13(11)18/h3-5,7,16H,6,15H2,1-2H3 |
| InChIKey | YJAWUSRBRMWRCD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|