About 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one
4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one (PubChem CID 146191540) has the molecular formula C13H17F3N2O
and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one.
Molecular Properties
| Compound Name | 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one |
| PubChem CID | 146191540 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one |
| SMILES | CC(C)n1ccc(C(N2CCC2)C(F)(F)F)cc1=O |
| InChI | InChI=1S/C13H17F3N2O/c1-9(2)18-7-4-10(8-11(18)19)12(13(14,15)16)17-5-3-6-17/h4,7-9,12H,3,5-6H2,1-2H3 |
| InChIKey | OFWNQYGTPJTGMN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one?
The IUPAC name of 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one (CID 146191540) is 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one.
What is the SMILES notation for 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one?
The canonical SMILES for 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one is CC(C)n1ccc(C(N2CCC2)C(F)(F)F)cc1=O.
What is the InChIKey of 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one?
The InChIKey is OFWNQYGTPJTGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O/c1-9(2)18-7-4-10(8-11(18)19)12(13(14,15)16)17-5-3-6-17/h4,7-9,12H,3,5-6H2,1-2H3.
What are the key properties of 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one?
4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one has a molecular weight of 274.29 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(azetidin-1-yl)-2,2,2-trifluoroethyl]-1-propan-2-ylpyridin-2-one is sourced from PubChem (CID 146191540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).