C27H32F2N6O3 — CID 146192669
(2S)-2-[[1-(difluoromethyl)indazole-5-carbonyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 146192669) has the molecular formula C27H32F2N6O3 and a molecular weight of 526.59 g/mol. Its IUPAC name is (2S)-2-[[1-(difluoromethyl)indazole-5-carbonyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[[1-(difluoromethyl)indazole-5-carbonyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146192669 |
| Molecular Formula | C27H32F2N6O3 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (2S)-2-[[1-(difluoromethyl)indazole-5-carbonyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(N[C@@H](CCN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)C(=O)O)c1ccc2c(cnn2C(F)F)c1 |
| InChI | InChI=1S/C27H32F2N6O3/c28-27(29)35-23-8-5-19(14-20(23)15-31-35)25(36)33-22(26(37)38)10-13-34-12-9-17(16-34)3-6-21-7-4-18-2-1-11-30-24(18)32-21/h4-5,7-8,14-15,17,22,27H,1-3,6,9-13,16H2,(H,30,32)(H,33,36)(H,37,38)/t17-,22+/m1/s1 |
| InChIKey | RGYMCYCSFXQTBG-VGSWGCGISA-N |
| XLogP | 3.71 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |