C27H34N6O3 — CID 146192691
(2R)-2-[(1-methylindazole-6-carbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 146192691) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is (2R)-2-[(1-methylindazole-6-carbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | (2R)-2-[(1-methylindazole-6-carbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146192691 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (2R)-2-[(1-methylindazole-6-carbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | Cn1ncc2ccc(C(=O)N[C@H](CCN3CC[C@@H](CCc4ccc5c(n4)NCCC5)C3)C(=O)O)cc21 |
| InChI | InChI=1S/C27H34N6O3/c1-32-24-15-20(5-6-21(24)16-29-32)26(34)31-23(27(35)36)11-14-33-13-10-18(17-33)4-8-22-9-7-19-3-2-12-28-25(19)30-22/h5-7,9,15-16,18,23H,2-4,8,10-14,17H2,1H3,(H,28,30)(H,31,34)(H,35,36)/t18-,23-/m1/s1 |
| InChIKey | FDCZJQLSRGTHTB-WZONZLPQSA-N |
| XLogP | 2.85 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |