C25H36F2N4O3 — CID 146192717
(2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 146192717) has the molecular formula C25H36F2N4O3 and a molecular weight of 478.58 g/mol. Its IUPAC name is (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146192717 |
| Molecular Formula | C25H36F2N4O3 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(N[C@@H](CCN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)C(=O)O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H36F2N4O3/c26-25(27)11-7-19(8-12-25)23(32)30-21(24(33)34)10-15-31-14-9-17(16-31)3-5-20-6-4-18-2-1-13-28-22(18)29-20/h4,6,17,19,21H,1-3,5,7-16H2,(H,28,29)(H,30,32)(H,33,34)/t17-,21+/m1/s1 |
| InChIKey | IPTHHKDYSUSKFC-UTKZUKDTSA-N |
| XLogP | 3.48 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |