C23H18ClF8NO4 — CID 146192998
(2,3,4,5,6-pentafluorophenyl) 7-chloro-2,4-dimethyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxylate (PubChem CID 146192998) has the molecular formula C23H18ClF8NO4 and a molecular weight of 559.84 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 7-chloro-2,4-dimethyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 7-chloro-2,4-dimethyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 146192998 |
| Molecular Formula | C23H18ClF8NO4 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 7-chloro-2,4-dimethyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc(Cl)c2c1OC(C)(C1CCN(CC(F)(F)F)CC1)O2 |
| InChI | InChI=1S/C23H18ClF8NO4/c1-9-11(21(34)35-20-16(28)14(26)13(25)15(27)17(20)29)7-12(24)19-18(9)36-22(2,37-19)10-3-5-33(6-4-10)8-23(30,31)32/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | XKJSLXDOHIFZPO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|