About dimethyl 2-nitrohexadecanedioate
dimethyl 2-nitrohexadecanedioate (PubChem CID 146193029) has the molecular formula C18H33NO6
and a molecular weight of 359.46 g/mol. Its IUPAC name is dimethyl 2-nitrohexadecanedioate.
Molecular Properties
| Compound Name | dimethyl 2-nitrohexadecanedioate |
| PubChem CID | 146193029 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | dimethyl 2-nitrohexadecanedioate |
| SMILES | COC(=O)CCCCCCCCCCCCCC(C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C18H33NO6/c1-24-17(20)15-13-11-9-7-5-3-4-6-8-10-12-14-16(19(22)23)18(21)25-2/h16H,3-15H2,1-2H3 |
| InChIKey | WGDZAEJOCHPWCQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-nitrohexadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-nitrohexadecanedioate?
The IUPAC name of dimethyl 2-nitrohexadecanedioate (CID 146193029) is dimethyl 2-nitrohexadecanedioate.
What is the SMILES notation for dimethyl 2-nitrohexadecanedioate?
The canonical SMILES for dimethyl 2-nitrohexadecanedioate is COC(=O)CCCCCCCCCCCCCC(C(=O)OC)[N+](=O)[O-].
What is the InChIKey of dimethyl 2-nitrohexadecanedioate?
The InChIKey is WGDZAEJOCHPWCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO6/c1-24-17(20)15-13-11-9-7-5-3-4-6-8-10-12-14-16(19(22)23)18(21)25-2/h16H,3-15H2,1-2H3.
What are the key properties of dimethyl 2-nitrohexadecanedioate?
dimethyl 2-nitrohexadecanedioate has a molecular weight of 359.46 g/mol, XLogP of 4.05, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-nitrohexadecanedioate is sourced from PubChem (CID 146193029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).