About N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide
N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 146193088) has the molecular formula C15H24N4O2S
and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 146193088 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC(C)C2CCN(C(=O)C(C)N)CC2)s1 |
| InChI | InChI=1S/C15H24N4O2S/c1-9-8-17-14(22-9)13(20)18-11(3)12-4-6-19(7-5-12)15(21)10(2)16/h8,10-12H,4-7,16H2,1-3H3,(H,18,20) |
| InChIKey | HXYOGSRZBHOXMA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide (CID 146193088) is N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide is Cc1cnc(C(=O)NC(C)C2CCN(C(=O)C(C)N)CC2)s1.
What is the InChIKey of N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide?
The InChIKey is HXYOGSRZBHOXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2S/c1-9-8-17-14(22-9)13(20)18-11(3)12-4-6-19(7-5-12)15(21)10(2)16/h8,10-12H,4-7,16H2,1-3H3,(H,18,20).
What are the key properties of N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide?
N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide has a molecular weight of 324.45 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(2-aminopropanoyl)piperidin-4-yl]ethyl]-5-methyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 146193088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).