About 2-(1,2-diethyl-2-pyridinyl)ethanol
2-(1,2-diethyl-2-pyridinyl)ethanol (PubChem CID 146193295) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-(1,2-diethyl-2-pyridinyl)ethanol.
Molecular Properties
| Compound Name | 2-(1,2-diethyl-2-pyridinyl)ethanol |
| PubChem CID | 146193295 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-(1,2-diethyl-2-pyridinyl)ethanol |
| SMILES | CCN1C=CC=CC1(CC)CCO |
| InChI | InChI=1S/C11H19NO/c1-3-11(8-10-13)7-5-6-9-12(11)4-2/h5-7,9,13H,3-4,8,10H2,1-2H3 |
| InChIKey | AAFMOKANRIPBBW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,2-diethyl-2-pyridinyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-diethyl-2-pyridinyl)ethanol?
The IUPAC name of 2-(1,2-diethyl-2-pyridinyl)ethanol (CID 146193295) is 2-(1,2-diethyl-2-pyridinyl)ethanol.
What is the SMILES notation for 2-(1,2-diethyl-2-pyridinyl)ethanol?
The canonical SMILES for 2-(1,2-diethyl-2-pyridinyl)ethanol is CCN1C=CC=CC1(CC)CCO.
What is the InChIKey of 2-(1,2-diethyl-2-pyridinyl)ethanol?
The InChIKey is AAFMOKANRIPBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-11(8-10-13)7-5-6-9-12(11)4-2/h5-7,9,13H,3-4,8,10H2,1-2H3.
What are the key properties of 2-(1,2-diethyl-2-pyridinyl)ethanol?
2-(1,2-diethyl-2-pyridinyl)ethanol has a molecular weight of 181.28 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-diethyl-2-pyridinyl)ethanol is sourced from PubChem (CID 146193295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).