C25H27N7O2 — CID 146193310
2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-pyridin-4-yloxyethyl)acetamide (PubChem CID 146193310) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-pyridin-4-yloxyethyl)acetamide.
| Compound Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-pyridin-4-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 146193310 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(2-pyridin-4-yloxyethyl)acetamide |
| SMILES | N#CCC1CCC(n2c(CC(=O)NCCOc3ccncc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C25H27N7O2/c26-9-5-17-1-3-18(4-2-17)32-22(31-21-16-30-25-20(24(21)32)8-12-29-25)15-23(33)28-13-14-34-19-6-10-27-11-7-19/h6-8,10-12,16-18H,1-5,13-15H2,(H,28,33)(H,29,30) |
| InChIKey | VWSVHIVHYKSSQL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|