C27H28ClF3N2O4S — CID 146193495
3-chloro-N-[(4-ethylsulfonylphenyl)methyl]-1-[[4-(trifluoromethyl)cyclohexyl]methoxy]isoquinoline-6-carboxamide (PubChem CID 146193495) has the molecular formula C27H28ClF3N2O4S and a molecular weight of 569.05 g/mol. Its IUPAC name is 3-chloro-N-[(4-ethylsulfonylphenyl)methyl]-1-[[4-(trifluoromethyl)cyclohexyl]methoxy]isoquinoline-6-carboxamide.
| Compound Name | 3-chloro-N-[(4-ethylsulfonylphenyl)methyl]-1-[[4-(trifluoromethyl)cyclohexyl]methoxy]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 146193495 |
| Molecular Formula | C27H28ClF3N2O4S |
| Molecular Weight | 569.05 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 3-chloro-N-[(4-ethylsulfonylphenyl)methyl]-1-[[4-(trifluoromethyl)cyclohexyl]methoxy]isoquinoline-6-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(OCC4CCC(C(F)(F)F)CC4)nc(Cl)cc3c2)cc1 |
| InChI | InChI=1S/C27H28ClF3N2O4S/c1-2-38(35,36)22-10-5-17(6-11-22)15-32-25(34)19-7-12-23-20(13-19)14-24(28)33-26(23)37-16-18-3-8-21(9-4-18)27(29,30)31/h5-7,10-14,18,21H,2-4,8-9,15-16H2,1H3,(H,32,34) |
| InChIKey | DWOPMJJNLPEPSJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.05 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|