About 2-(2-ethylphenyl)azepane;hydrochloride
2-(2-ethylphenyl)azepane;hydrochloride (PubChem CID 146193845) has the molecular formula C14H22ClN
and a molecular weight of 239.79 g/mol. Its IUPAC name is 2-(2-ethylphenyl)azepane;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-ethylphenyl)azepane;hydrochloride |
| PubChem CID | 146193845 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(2-ethylphenyl)azepane;hydrochloride |
| SMILES | CCc1ccccc1C1CCCCCN1.Cl |
| InChI | InChI=1S/C14H21N.ClH/c1-2-12-8-5-6-9-13(12)14-10-4-3-7-11-15-14;/h5-6,8-9,14-15H,2-4,7,10-11H2,1H3;1H |
| InChIKey | MUBDFEHJZFHTRZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-ethylphenyl)azepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylphenyl)azepane;hydrochloride?
The IUPAC name of 2-(2-ethylphenyl)azepane;hydrochloride (CID 146193845) is 2-(2-ethylphenyl)azepane;hydrochloride.
What is the SMILES notation for 2-(2-ethylphenyl)azepane;hydrochloride?
The canonical SMILES for 2-(2-ethylphenyl)azepane;hydrochloride is CCc1ccccc1C1CCCCCN1.Cl.
What is the InChIKey of 2-(2-ethylphenyl)azepane;hydrochloride?
The InChIKey is MUBDFEHJZFHTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N.ClH/c1-2-12-8-5-6-9-13(12)14-10-4-3-7-11-15-14;/h5-6,8-9,14-15H,2-4,7,10-11H2,1H3;1H.
What are the key properties of 2-(2-ethylphenyl)azepane;hydrochloride?
2-(2-ethylphenyl)azepane;hydrochloride has a molecular weight of 239.79 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylphenyl)azepane;hydrochloride is sourced from PubChem (CID 146193845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).