About 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one
2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one (PubChem CID 146193927) has the molecular formula C11H13ClN4O
and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one.
Molecular Properties
| Compound Name | 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one |
| PubChem CID | 146193927 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one |
| SMILES | Cc1nc(Cl)nc2c1NC(=O)C1(CCC1)N2C |
| InChI | InChI=1S/C11H13ClN4O/c1-6-7-8(15-10(12)13-6)16(2)11(4-3-5-11)9(17)14-7/h3-5H2,1-2H3,(H,14,17) |
| InChIKey | UXXSXMXISUKHAZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one?
The IUPAC name of 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one (CID 146193927) is 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one.
What is the SMILES notation for 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one?
The canonical SMILES for 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one is Cc1nc(Cl)nc2c1NC(=O)C1(CCC1)N2C.
What is the InChIKey of 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one?
The InChIKey is UXXSXMXISUKHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4O/c1-6-7-8(15-10(12)13-6)16(2)11(4-3-5-11)9(17)14-7/h3-5H2,1-2H3,(H,14,17).
What are the key properties of 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one?
2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one has a molecular weight of 252.70 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,8-dimethylspiro[5H-pteridine-7,1'-cyclobutane]-6-one is sourced from PubChem (CID 146193927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).