C9H11ClN4O — CID 146193989
(7S)-2-chloro-4,7,8-trimethyl-5,7-dihydropteridin-6-one (PubChem CID 146193989) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is (7S)-2-chloro-4,7,8-trimethyl-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-2-chloro-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146193989 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (7S)-2-chloro-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(Cl)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C9H11ClN4O/c1-4-6-7(13-9(10)11-4)14(3)5(2)8(15)12-6/h5H,1-3H3,(H,12,15)/t5-/m0/s1 |
| InChIKey | HUXJAOAEDUBAAW-YFKPBYRVSA-N |
| XLogP | 1.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |