C21H24F3N5O2 — CID 146194616
(7S)-4,5,7,8-tetramethyl-2-[[(1R,3R)-3-(3,4,5-trifluorophenoxy)cyclopentyl]amino]-7H-pteridin-6-one (PubChem CID 146194616) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is (7S)-4,5,7,8-tetramethyl-2-[[(1R,3R)-3-(3,4,5-trifluorophenoxy)cyclopentyl]amino]-7H-pteridin-6-one.
| Compound Name | (7S)-4,5,7,8-tetramethyl-2-[[(1R,3R)-3-(3,4,5-trifluorophenoxy)cyclopentyl]amino]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 146194616 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (7S)-4,5,7,8-tetramethyl-2-[[(1R,3R)-3-(3,4,5-trifluorophenoxy)cyclopentyl]amino]-7H-pteridin-6-one |
| SMILES | Cc1nc(N[C@@H]2CC[C@@H](Oc3cc(F)c(F)c(F)c3)C2)nc2c1N(C)C(=O)[C@H](C)N2C |
| InChI | InChI=1S/C21H24F3N5O2/c1-10-18-19(28(3)11(2)20(30)29(18)4)27-21(25-10)26-12-5-6-13(7-12)31-14-8-15(22)17(24)16(23)9-14/h8-9,11-13H,5-7H2,1-4H3,(H,25,26,27)/t11-,12+,13+/m0/s1 |
| InChIKey | ZEYOQKIZAOBYRJ-YNEHKIRRSA-N |
| XLogP | 3.42 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|