C21H24F3N5O3 — CID 146195117
7-(methoxymethyl)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]amino]-5H-pteridin-6-one (PubChem CID 146195117) has the molecular formula C21H24F3N5O3 and a molecular weight of 451.45 g/mol. Its IUPAC name is 7-(methoxymethyl)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]amino]-5H-pteridin-6-one.
| Compound Name | 7-(methoxymethyl)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]amino]-5H-pteridin-6-one |
|---|---|
| PubChem CID | 146195117 |
| Molecular Formula | C21H24F3N5O3 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 7-(methoxymethyl)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]amino]-5H-pteridin-6-one |
| SMILES | COCC1(C)C(=O)Nc2c(C)nc(NC3CC(Oc4cc(F)c(F)c(F)c4)C3)nc2N1C |
| InChI | InChI=1S/C21H24F3N5O3/c1-10-17-18(29(3)21(2,9-31-4)19(30)27-17)28-20(25-10)26-11-5-12(6-11)32-13-7-14(22)16(24)15(23)8-13/h7-8,11-12H,5-6,9H2,1-4H3,(H,27,30)(H,25,26,28) |
| InChIKey | WUMJCWWPULQCTH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|