About [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine
[1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine (PubChem CID 146195331) has the molecular formula C15H18F2N4
and a molecular weight of 292.33 g/mol. Its IUPAC name is [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine |
| PubChem CID | 146195331 |
| Molecular Formula | C15H18F2N4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine |
| SMILES | NCc1cnn(CC2CCCN2c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H18F2N4/c16-12-4-13(17)6-15(5-12)21-3-1-2-14(21)10-20-9-11(7-18)8-19-20/h4-6,8-9,14H,1-3,7,10,18H2 |
| InChIKey | IGPAHAYIRGBCIC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine?
The IUPAC name of [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine (CID 146195331) is [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine.
What is the SMILES notation for [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine?
The canonical SMILES for [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine is NCc1cnn(CC2CCCN2c2cc(F)cc(F)c2)c1.
What is the InChIKey of [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine?
The InChIKey is IGPAHAYIRGBCIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N4/c16-12-4-13(17)6-15(5-12)21-3-1-2-14(21)10-20-9-11(7-18)8-19-20/h4-6,8-9,14H,1-3,7,10,18H2.
What are the key properties of [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine?
[1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine has a molecular weight of 292.33 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[1-(3,5-difluorophenyl)pyrrolidin-2-yl]methyl]pyrazol-4-yl]methanamine is sourced from PubChem (CID 146195331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).