C20H19FN6O2S — CID 146195972
2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-4-[[5-[2-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl)ethynyl]thiophen-2-yl]methyl]-1,2,4-triazol-3-one (PubChem CID 146195972) has the molecular formula C20H19FN6O2S and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-4-[[5-[2-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl)ethynyl]thiophen-2-yl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-4-[[5-[2-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl)ethynyl]thiophen-2-yl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 146195972 |
| Molecular Formula | C20H19FN6O2S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-4-[[5-[2-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl)ethynyl]thiophen-2-yl]methyl]-1,2,4-triazol-3-one |
| SMILES | NC/C(=C\F)Cn1ncn(Cc2ccc(C#Cc3ccc4c(n3)OCCN4)s2)c1=O |
| InChI | InChI=1S/C20H19FN6O2S/c21-9-14(10-22)11-27-20(28)26(13-24-27)12-17-5-4-16(30-17)3-1-15-2-6-18-19(25-15)29-8-7-23-18/h2,4-6,9,13,23H,7-8,10-12,22H2/b14-9+ |
| InChIKey | FVKALIXRQOPVBE-NTEUORMPSA-N |
| XLogP | 1.57 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|