C33H34ClFN4O5 — CID 146196806
ethyl 6-chloro-4-[4-[4-fluoro-2-(1-phenylmethoxycarbonylpyrrolidin-2-yl)phenoxy]butylamino]-1,5-naphthyridine-3-carboxylate (PubChem CID 146196806) has the molecular formula C33H34ClFN4O5 and a molecular weight of 621.11 g/mol. Its IUPAC name is ethyl 6-chloro-4-[4-[4-fluoro-2-(1-phenylmethoxycarbonylpyrrolidin-2-yl)phenoxy]butylamino]-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[4-[4-fluoro-2-(1-phenylmethoxycarbonylpyrrolidin-2-yl)phenoxy]butylamino]-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 146196806 |
| Molecular Formula | C33H34ClFN4O5 |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | ethyl 6-chloro-4-[4-[4-fluoro-2-(1-phenylmethoxycarbonylpyrrolidin-2-yl)phenoxy]butylamino]-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)nc2c1NCCCCOc1ccc(F)cc1C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H34ClFN4O5/c1-2-42-32(40)25-20-37-26-13-15-29(34)38-31(26)30(25)36-16-6-7-18-43-28-14-12-23(35)19-24(28)27-11-8-17-39(27)33(41)44-21-22-9-4-3-5-10-22/h3-5,9-10,12-15,19-20,27H,2,6-8,11,16-18,21H2,1H3,(H,36,37) |
| InChIKey | MRCCMPTUZKVSMB-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|