About N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide
N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197707) has the molecular formula C20H27N3O2S
and a molecular weight of 373.52 g/mol. Its IUPAC name is N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide |
| PubChem CID | 146197707 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)c2ccc(C)cc2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C20H27N3O2S/c1-7-22(4)14-21-18-12-16(3)19(13-20(18)26(6,24)25)23(5)17-10-8-15(2)9-11-17/h8-14H,7H2,1-6H3/b21-14+ |
| InChIKey | XNKOHUBBBCHBPJ-KGENOOAVSA-N |
| XLogP | 4.09 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide?
The IUPAC name of N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide (CID 146197707) is N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide.
What is the SMILES notation for N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide?
The canonical SMILES for N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide is CCN(C)/C=N/c1cc(C)c(N(C)c2ccc(C)cc2)cc1S(C)(=O)=O.
What is the InChIKey of N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide?
The InChIKey is XNKOHUBBBCHBPJ-KGENOOAVSA-N. The full InChI is InChI=1S/C20H27N3O2S/c1-7-22(4)14-21-18-12-16(3)19(13-20(18)26(6,24)25)23(5)17-10-8-15(2)9-11-17/h8-14H,7H2,1-6H3/b21-14+.
What are the key properties of N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide?
N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide has a molecular weight of 373.52 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(N,4-dimethylanilino)-5-methyl-2-methylsulfonylphenyl]-N-ethyl-N-methylmethanimidamide is sourced from PubChem (CID 146197707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).