About methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate
methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate (PubChem CID 146198245) has the molecular formula C15H17N3O4
and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate |
| PubChem CID | 146198245 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(N2CCC3(CCC(=O)NC3=O)C2)n1 |
| InChI | InChI=1S/C15H17N3O4/c1-22-13(20)10-3-2-4-11(16-10)18-8-7-15(9-18)6-5-12(19)17-14(15)21/h2-4H,5-9H2,1H3,(H,17,19,21) |
| InChIKey | CLLLSNBLTMBAMO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate (CID 146198245) is methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate is COC(=O)c1cccc(N2CCC3(CCC(=O)NC3=O)C2)n1.
What is the InChIKey of methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate?
The InChIKey is CLLLSNBLTMBAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O4/c1-22-13(20)10-3-2-4-11(16-10)18-8-7-15(9-18)6-5-12(19)17-14(15)21/h2-4H,5-9H2,1H3,(H,17,19,21).
What are the key properties of methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate?
methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate has a molecular weight of 303.32 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)pyridine-2-carboxylate is sourced from PubChem (CID 146198245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).