C15H15N3O2S — CID 146198274
2-(1,3-benzothiazol-2-yl)-2,7-diazaspiro[4.5]decane-6,8-dione (PubChem CID 146198274) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2,7-diazaspiro[4.5]decane-6,8-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2,7-diazaspiro[4.5]decane-6,8-dione |
|---|---|
| PubChem CID | 146198274 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2,7-diazaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCN(c3nc4ccccc4s3)C2)C(=O)N1 |
| InChI | InChI=1S/C15H15N3O2S/c19-12-5-6-15(13(20)17-12)7-8-18(9-15)14-16-10-3-1-2-4-11(10)21-14/h1-4H,5-9H2,(H,17,19,20) |
| InChIKey | YVQKTFGXZGHQOQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|